CAS 121244-83-5 is the registry number for Misonidazole-d3. Offered by: TRC. Available pack sizes: 100mg.
1-(2-nitroimidazol-1-yl)-3-(trideuteriomethoxy)propan-2-ol (CAS 121244-83-5) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 204.20 g/mol. IUPAC name: 1-(2-nitroimidazol-1-yl)-3-(trideuteriomethoxy)propan-2-ol. InChIKey: OBBCSXFCDPPXOL-FIBGUPNXSA-N.
| Molecular formula | C7H11N3O4 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 1-(2-nitroimidazol-1-yl)-3-(trideuteriomethoxy)propan-2-ol |
| InChIKey | OBBCSXFCDPPXOL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OCC(CN1C=CN=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)