Products 1010800-83-5
CAS 1010800-83-5 is the registry number for Tert-butyl 2,5-difluoro-4-methoxybenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2,5-difluoro-4-methoxybenzoate (CAS 1010800-83-5) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: tert-butyl 2,5-difluoro-4-methoxybenzoate. InChIKey: DCHLUDAHEUOQQO-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O3 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | tert-butyl 2,5-difluoro-4-methoxybenzoate |
| InChIKey | DCHLUDAHEUOQQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1F)OC)F |
Computed by PubChem (NCBI)