Products 1275972-35-4
CAS 1275972-35-4 is the registry number for Ethyl 3-(2,4-difluorophenyl)-3-hydroxybutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(2,4-difluorophenyl)-3-hydroxybutanoate (CAS 1275972-35-4) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: ethyl 3-(2,4-difluorophenyl)-3-hydroxybutanoate. InChIKey: OSCJVHGHYJBFRU-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O3 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | ethyl 3-(2,4-difluorophenyl)-3-hydroxybutanoate |
| InChIKey | OSCJVHGHYJBFRU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)(C1=C(C=C(C=C1)F)F)O |
Computed by PubChem (NCBI)