Products 1285101-00-9

CAS 1285101-00-9 is the registry number for Ethyl 2-(4-Ethoxyphenyl)-2,2-difluoroacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate (CAS 1285101-00-9) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: ethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate. InChIKey: GAEQNBWOUNINSN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14F2O3
Molecular weight244.23 g/mol
IUPAC nameethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate
InChIKeyGAEQNBWOUNINSN-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)C(C(=O)OCC)(F)F

Computed by PubChem (NCBI)