Products 1239964-17-0
CAS 1239964-17-0 appears in our catalog under these names: tert-Butyl 3,5-difluoro-4-(hydroxymethyl)benzoate, 95%, tert-Butyl 3,5-difluoro-4-(hydroxymethyl)benzoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 3,5-difluoro-4-(hydroxymethyl)benzoate (CAS 1239964-17-0) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: tert-butyl 3,5-difluoro-4-(hydroxymethyl)benzoate. InChIKey: UQXHOULFCLJBCV-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O3 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | tert-butyl 3,5-difluoro-4-(hydroxymethyl)benzoate |
| InChIKey | UQXHOULFCLJBCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C(=C1)F)CO)F |
Computed by PubChem (NCBI)