CAS 152123-58-5 appears in our catalog under these names: Ethyl 2,2-difluoro-3-hydroxy-3-phenylbutanoate, 95%, Ethyl 2,2-difluoro-3-hydroxy-3-phenylbutanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 2,2-difluoro-3-hydroxy-3-phenylbutanoate (CAS 152123-58-5) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: ethyl 2,2-difluoro-3-hydroxy-3-phenylbutanoate. InChIKey: ILFQGBWKIKNCCJ-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O3 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | ethyl 2,2-difluoro-3-hydroxy-3-phenylbutanoate |
| InChIKey | ILFQGBWKIKNCCJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)(C1=CC=CC=C1)O)(F)F |
Computed by PubChem (NCBI)