Products 1443353-84-1

CAS 1443353-84-1 is the registry number for Ethyl 4-(2,4-difluoro-phenoxy)butanoate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(2,4-difluorophenoxy)butanoate (CAS 1443353-84-1) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: ethyl 4-(2,4-difluorophenoxy)butanoate. InChIKey: VNACIAPXRFMZTP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14F2O3
Molecular weight244.23 g/mol
IUPAC nameethyl 4-(2,4-difluorophenoxy)butanoate
InChIKeyVNACIAPXRFMZTP-UHFFFAOYSA-N
SMILESCCOC(=O)CCCOC1=C(C=C(C=C1)F)F

Computed by PubChem (NCBI)