Products 2504203-90-9
CAS 2504203-90-9 appears in our catalog under these names: Ethyl 2,3-difluoro-4-isopropoxybenzoate, 95%, Ethyl 2,3-difluoro-4-isopropoxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 2,3-difluoro-4-propan-2-yloxybenzoate (CAS 2504203-90-9) is a chemical compound with the molecular formula C12H14F2O3 and a molecular weight of 244.23 g/mol. IUPAC name: ethyl 2,3-difluoro-4-propan-2-yloxybenzoate. InChIKey: JZSRFGXJMGGNDD-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O3 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | ethyl 2,3-difluoro-4-propan-2-yloxybenzoate |
| InChIKey | JZSRFGXJMGGNDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)OC(C)C)F)F |
Computed by PubChem (NCBI)