CAS 101207-50-5 appears in our catalog under these names: Methyl 3-amino-3-(4-methylphenyl)propanoate hydrochloride, 95%, Methyl 3-amino-3-(p-tolyl)propanoate hydrochloride, 97%, Methyl 3-amino-3-(4-methylphenyl)propanoate hydrochloride, Methyl 3-amino-3-(4-methylphenyl)propanoate hydrochloride, 97%, 97%, Methyl 3-amino-3-(4-methylphenyl)propanoate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg, 500mg.
Methyl 3-amino-3-(4-methylphenyl)propanoate;hydrochloride (CAS 101207-50-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl 3-amino-3-(4-methylphenyl)propanoate;hydrochloride. InChIKey: VUDNJAZNBRXDQR-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl 3-amino-3-(4-methylphenyl)propanoate;hydrochloride |
| InChIKey | VUDNJAZNBRXDQR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)