CAS 1013647-75-0 appears in our catalog under these names: tert-Butyl 2,6-dichloronicotinate, 96%, tert-Butyl 2,6-Dichloronicotinate, tert-Butyl 2,6-dichloropyridine-3-carboxylate 95%, 2,6-Dichloronicotinic acid tert-butyl ester, 98%, 98%, tert-Butyl 2,6-dichloronicotinate, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 2,5g, 10g, 25g, 100g, 100mg, 250mg.
Tert-butyl 2,6-dichloropyridine-3-carboxylate (CAS 1013647-75-0) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 2,6-dichloropyridine-3-carboxylate. InChIKey: GTWXYRAFRYVGNS-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 2,6-dichloropyridine-3-carboxylate |
| InChIKey | GTWXYRAFRYVGNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)