Products 1014018-07-5

CAS 1014018-07-5 is the registry number for Cis-4-phenylpiperidine-3-carboxylic acid, n-fmoc protected, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(3R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpiperidine-3-carboxylic acid (CAS 1014018-07-5) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (3R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpiperidine-3-carboxylic acid. InChIKey: OYQJCYXNLDUARS-CYFREDJKSA-N.

Identity
Molecular formulaC27H25NO4
Molecular weight427.5 g/mol
IUPAC name(3R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpiperidine-3-carboxylic acid
InChIKeyOYQJCYXNLDUARS-CYFREDJKSA-N
SMILESC1CN(C[C@@H]([C@@H]1C2=CC=CC=C2)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35

Computed by PubChem (NCBI)