CAS 332064-75-2 appears in our catalog under these names: Fmoc-(r)-3-amino-(6-phenyl)-5-hexenoic acid, 95%, Fmoc–(R)–3–amino–6–phenyl–5–hexenoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(E,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid (CAS 332064-75-2) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (E,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid. InChIKey: MLWHGLZHUJARIA-OJLWIZQOSA-N.
| Molecular formula | C27H25NO4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (E,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid |
| InChIKey | MLWHGLZHUJARIA-OJLWIZQOSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)