CAS 1217460-65-5 is the registry number for (S,E)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-phenylhex-5-enoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
(E,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid (CAS 1217460-65-5) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (E,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid. InChIKey: MLWHGLZHUJARIA-ZBWUASRJSA-N.
| Molecular formula | C27H25NO4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (E,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid |
| InChIKey | MLWHGLZHUJARIA-ZBWUASRJSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)