CAS 270596-45-7 appears in our catalog under these names: Fmoc-(S)-3-Amino-(6-phenyl)-5-hexenoic acid, 97%, Fmoc–styryl–L–beta–homoalanine, Fmoc-(S)-3-Amino-(6-phenyl)-5-hexenoic acid, 98%, 98%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(E,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid (CAS 270596-45-7) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (E,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid. InChIKey: MLWHGLZHUJARIA-ZBWUASRJSA-N.
| Molecular formula | C27H25NO4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (E,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenylhex-5-enoic acid |
| InChIKey | MLWHGLZHUJARIA-ZBWUASRJSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)