CAS 2254830-90-3 appears in our catalog under these names: Fmoc-(R)-α-Benzyl-proline, 95%, (2R)-2-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid, ≥95%, ≥95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g.
(2R)-2-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 2254830-90-3) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (2R)-2-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: KCBAWPJTUBLDLJ-HHHXNRCGSA-N.
| Molecular formula | C27H25NO4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (2R)-2-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | KCBAWPJTUBLDLJ-HHHXNRCGSA-N |
| SMILES | C1C[C@@](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(CC5=CC=CC=C5)C(=O)O |
Computed by PubChem (NCBI)