Products 2349725-34-2
CAS 2349725-34-2 is the registry number for Fmoc-(1-phenylcyclopropy)-D-Ala-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-phenylcyclopropyl)propanoic acid (CAS 2349725-34-2) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-phenylcyclopropyl)propanoic acid. InChIKey: BOUIXINWDUFZCE-XMMPIXPASA-N.
| Molecular formula | C27H25NO4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-phenylcyclopropyl)propanoic acid |
| InChIKey | BOUIXINWDUFZCE-XMMPIXPASA-N |
| SMILES | C1CC1(C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5=CC=CC=C5 |
Computed by PubChem (NCBI)