Products 215190-19-5

CAS 215190-19-5 is the registry number for Ph-Pip(Fmoc)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpiperidine-4-carboxylic acid (CAS 215190-19-5) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpiperidine-4-carboxylic acid. InChIKey: JWEBOBGECOQGTL-UHFFFAOYSA-N.

Identity
Molecular formulaC27H25NO4
Molecular weight427.5 g/mol
IUPAC name1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylpiperidine-4-carboxylic acid
InChIKeyJWEBOBGECOQGTL-UHFFFAOYSA-N
SMILESC1CN(CCC1(C2=CC=CC=C2)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35

Computed by PubChem (NCBI)