Products 101421-33-4

CAS 101421-33-4 is the registry number for 2-Amino-3-bromo-5-iodobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-3-bromo-5-iodobenzoic acid (CAS 101421-33-4) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 2-amino-3-bromo-5-iodobenzoic acid. InChIKey: NMZSVILLNIVCIH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrINO2
Molecular weight341.93 g/mol
IUPAC name2-amino-3-bromo-5-iodobenzoic acid
InChIKeyNMZSVILLNIVCIH-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)N)Br)I

Computed by PubChem (NCBI)