CAS 1823494-61-6 is the registry number for 2-Amino-4-bromo-5-iodo-benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-amino-4-bromo-5-iodobenzoic acid (CAS 1823494-61-6) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 2-amino-4-bromo-5-iodobenzoic acid. InChIKey: SGPARYHKYWFJSJ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | 2-amino-4-bromo-5-iodobenzoic acid |
| InChIKey | SGPARYHKYWFJSJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)Br)N)C(=O)O |
Computed by PubChem (NCBI)