CAS 1174028-21-7 appears in our catalog under these names: Methyl 5-bromo-6-iodonicotinate, 95%, Methyl 5–bromo–6–iodonicotinate, Methyl 5-bromo-6-iodonicotinate, Methyl 5-bromo-6-iodonicotinate 97%, Methyl 5-bromo-6-iodonicotinate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 5g, 10g, 25g.
Methyl 5-bromo-6-iodopyridine-3-carboxylate (CAS 1174028-21-7) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: methyl 5-bromo-6-iodopyridine-3-carboxylate. InChIKey: WNPDQEDHQZXSOT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | methyl 5-bromo-6-iodopyridine-3-carboxylate |
| InChIKey | WNPDQEDHQZXSOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)I)Br |
Computed by PubChem (NCBI)