CAS 1261644-60-3 appears in our catalog under these names: 3-Iodo-5-nitrobenzyl bromide, 95%, 3-Iodo-5-nitrobenzyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-(bromomethyl)-3-iodo-5-nitrobenzene (CAS 1261644-60-3) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 1-(bromomethyl)-3-iodo-5-nitrobenzene. InChIKey: IIGPAZNWDKJFOH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | 1-(bromomethyl)-3-iodo-5-nitrobenzene |
| InChIKey | IIGPAZNWDKJFOH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])I)CBr |
Computed by PubChem (NCBI)