CAS 643086-28-6 is the registry number for 5-Bromo-7-iodobenzo[d][1,3]dioxol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-iodo-1,3-benzodioxol-4-amine (CAS 643086-28-6) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 5-bromo-7-iodo-1,3-benzodioxol-4-amine. InChIKey: YBUSEOZZVXDLKS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | 5-bromo-7-iodo-1,3-benzodioxol-4-amine |
| InChIKey | YBUSEOZZVXDLKS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(C=C(C(=C2O1)N)Br)I |
Computed by PubChem (NCBI)