CAS 2733075-09-5 is the registry number for Methyl 5-bromo-2-iodonicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-2-iodopyridine-3-carboxylate (CAS 2733075-09-5) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: methyl 5-bromo-2-iodopyridine-3-carboxylate. InChIKey: ZFRKLXSQBYKLFV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | methyl 5-bromo-2-iodopyridine-3-carboxylate |
| InChIKey | ZFRKLXSQBYKLFV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Br)I |
Computed by PubChem (NCBI)