CAS 101489-23-0 appears in our catalog under these names: 1-Methyl-7-nitro-1H-indole, 97%, 1-Methyl-7-nitro-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
1-methyl-7-nitroindole (CAS 101489-23-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methyl-7-nitroindole. InChIKey: FUPIEEZTCMDMTO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methyl-7-nitroindole |
| InChIKey | FUPIEEZTCMDMTO-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)