CAS 10154-71-9 appears in our catalog under these names: 3-(Phenylsulfonyl)propionic acid 97%, 3-(Phenylsulfonyl)propanoic acid, 98%, 98%, 3-(Phenylsulfonyl)propanoic acid, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g, 1g, 1kg.
3-(benzenesulfonyl)propanoic acid (CAS 10154-71-9) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 3-(benzenesulfonyl)propanoic acid. InChIKey: WGTYYNCSWCKXAI-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 3-(benzenesulfonyl)propanoic acid |
| InChIKey | WGTYYNCSWCKXAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)