CAS 101581-06-0 appears in our catalog under these names: 1,3–Dibromo–2–methyl–5–nitrobenzene, 1,3-Dibromo-2-methyl-5-nitrobenzene, 95%, 95%, 1,3-Dibromo-2-methyl-5-nitrobenzene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g, 100g.
1,3-dibromo-2-methyl-5-nitrobenzene (CAS 101581-06-0) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1,3-dibromo-2-methyl-5-nitrobenzene. InChIKey: HGDQAFSQPJJIFA-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1,3-dibromo-2-methyl-5-nitrobenzene |
| InChIKey | HGDQAFSQPJJIFA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)