CAS 1015855-87-4 appears in our catalog under these names: Ronidazole-d3, Ronidazole D3, Ronidazole-d3, >95% (HPLC), D3-Ronidazole, Concentration: 100 µg/ml Solvent: Methanol, D3-Ronidazole. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 10mg, 50mg, 5mg, 1x1ml, 1x10mg, 5 mg.
[5-nitro-1-(trideuteriomethyl)imidazol-2-yl]methyl carbamate (CAS 1015855-87-4) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 203.17 g/mol. IUPAC name: [5-nitro-1-(trideuteriomethyl)imidazol-2-yl]methyl carbamate. InChIKey: PQFRTXSWDXZRRS-FIBGUPNXSA-N.
| Molecular formula | C6H8N4O4 |
|---|---|
| Molecular weight | 203.17 g/mol |
| IUPAC name | [5-nitro-1-(trideuteriomethyl)imidazol-2-yl]methyl carbamate |
| InChIKey | PQFRTXSWDXZRRS-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=CN=C1COC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)