CAS 3346-61-0 appears in our catalog under these names: Pamabrom Impurity 1, 6-Amino-1,3-dimethyl-5-nitrosouracil, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g.
6-amino-1,3-dimethyl-5-nitropyrimidine-2,4-dione (CAS 3346-61-0) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. IUPAC name: 6-amino-1,3-dimethyl-5-nitropyrimidine-2,4-dione. InChIKey: IAAUBQWOEHOUOJ-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O4 |
|---|---|
| Molecular weight | 200.15 g/mol |
| IUPAC name | 6-amino-1,3-dimethyl-5-nitropyrimidine-2,4-dione |
| InChIKey | IAAUBQWOEHOUOJ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)[N+](=O)[O-])N |
Computed by PubChem (NCBI)