CAS 70965-24-1 appears in our catalog under these names: Ethyl (3-nitro-1h-1,2,4-triazol-1-yl)acetate, 95%, Ethyl 2-(3-nitro-1H-1,2,4-triazol-1-yl)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 2-(3-nitro-1,2,4-triazol-1-yl)acetate (CAS 70965-24-1) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. IUPAC name: ethyl 2-(3-nitro-1,2,4-triazol-1-yl)acetate. InChIKey: IJKYMLBNYHCLIH-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O4 |
|---|---|
| Molecular weight | 200.15 g/mol |
| IUPAC name | ethyl 2-(3-nitro-1,2,4-triazol-1-yl)acetate |
| InChIKey | IJKYMLBNYHCLIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=NC(=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)