CAS 53790-84-4 is the registry number for (1-Methyl-4-nitro-1H-imidazol-5-yl)glycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-methyl-5-nitroimidazol-4-yl)amino]acetic acid (CAS 53790-84-4) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. IUPAC name: 2-[(3-methyl-5-nitroimidazol-4-yl)amino]acetic acid. InChIKey: IRCMCCGSNGDMPR-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O4 |
|---|---|
| Molecular weight | 200.15 g/mol |
| IUPAC name | 2-[(3-methyl-5-nitroimidazol-4-yl)amino]acetic acid |
| InChIKey | IRCMCCGSNGDMPR-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)