Products 21936-97-0

CAS 21936-97-0 is the registry number for Methyl (3,5-dihydroxy-1,2,4-triazin-6-yl)glycinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetate (CAS 21936-97-0) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. IUPAC name: methyl 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetate. InChIKey: ZUIRCVDOLUPWDN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N4O4
Molecular weight200.15 g/mol
IUPAC namemethyl 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetate
InChIKeyZUIRCVDOLUPWDN-UHFFFAOYSA-N
SMILESCOC(=O)CNC1=NNC(=O)NC1=O

Computed by PubChem (NCBI)