CAS 163527-47-7 appears in our catalog under these names: 4-(3-Nitro-1h-1,2,4-triazol-1-yl)butanoic acid, 95%, 4-(3-Nitro-1H-1,2,4-triazol-1-yl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(3-nitro-1,2,4-triazol-1-yl)butanoic acid (CAS 163527-47-7) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. IUPAC name: 4-(3-nitro-1,2,4-triazol-1-yl)butanoic acid. InChIKey: VKHMLQUUROMVFW-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O4 |
|---|---|
| Molecular weight | 200.15 g/mol |
| IUPAC name | 4-(3-nitro-1,2,4-triazol-1-yl)butanoic acid |
| InChIKey | VKHMLQUUROMVFW-UHFFFAOYSA-N |
| SMILES | C1=NC(=NN1CCCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)