Products 21957-56-2

CAS 21957-56-2 is the registry number for 2-((3,5-Dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)amino)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanoic acid (CAS 21957-56-2) is a chemical compound with the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. IUPAC name: 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanoic acid. InChIKey: FOBYFMSGKFYQSX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N4O4
Molecular weight200.15 g/mol
IUPAC name2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]propanoic acid
InChIKeyFOBYFMSGKFYQSX-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC1=NNC(=O)NC1=O

Computed by PubChem (NCBI)