Products 1016163-89-5
CAS 1016163-89-5 appears in our catalog under these names: Methyl 5–bromo–2–formylbenzoate, Methyl 5-bromo-2-formylbenzoate, Methyl 5-bromo-2-formylbenzoate 95%, Methyl 5-bromo-2-formylbenzoate, 96%, Methyl 5-Bromo-2-formylbenzoate, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 50g, 10g, 25g, 100g.
Methyl 5-bromo-2-formylbenzoate (CAS 1016163-89-5) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 5-bromo-2-formylbenzoate. InChIKey: ZYGJVCDDZZSSEE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 5-bromo-2-formylbenzoate |
| InChIKey | ZYGJVCDDZZSSEE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)C=O |
Computed by PubChem (NCBI)