CAS 101623-83-0 is the registry number for ((Trimethylacetyl)oxy)methyl 4-Nitrophenyl Carbonate. Offered by: TRC. Available pack sizes: 250mg.
(4-nitrophenoxy)carbonyloxymethyl 2,2-dimethylpropanoate (CAS 101623-83-0) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: (4-nitrophenoxy)carbonyloxymethyl 2,2-dimethylpropanoate. InChIKey: DYFCTJYNLSDCOG-UHFFFAOYSA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | (4-nitrophenoxy)carbonyloxymethyl 2,2-dimethylpropanoate |
| InChIKey | DYFCTJYNLSDCOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)