CAS 194995-47-6 appears in our catalog under these names: 1-(((4-Nitrophenoxy)carbonyl)oxy)ethyl isobutyrate, 95%, 1–(((4–Nitrophenoxy)carbonyl)oxy)ethyl isobutyrate, 1-(((4-Nitrophenoxy)carbonyl)oxy)ethyl isobutyrate 95%, 1-(((4-Nitrophenoxy)Carbonyl)Oxy)Ethyl Isobutyrate, 95%, 95%, 1-(((4-Nitrophenoxy)carbonyl)oxy)ethyl isobutyrate, 99.93%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g, 10g, 500 mg, 25 g.
1-(4-nitrophenoxy)carbonyloxyethyl 2-methylpropanoate (CAS 194995-47-6) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: 1-(4-nitrophenoxy)carbonyloxyethyl 2-methylpropanoate. InChIKey: BYKGARIWNYRANY-UHFFFAOYSA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 1-(4-nitrophenoxy)carbonyloxyethyl 2-methylpropanoate |
| InChIKey | BYKGARIWNYRANY-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC(C)OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)