CAS 120085-63-4 appears in our catalog under these names: 4,5,7-Tri-o-acetyl-2,6-anhydro-3-deoxy-d-lyxo-hept-2-enononitrile, 95%, 4,5,7-Tri-O-acetyl-2,6-anhydro-3-deoxy-D-lyxo-hept-2-enononitrile. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10g, 5g, 25g.
[(2R,3R,4R)-3,4-diacetyloxy-6-cyano-3,4-dihydro-2H-pyran-2-yl]methyl acetate (CAS 120085-63-4) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: [(2R,3R,4R)-3,4-diacetyloxy-6-cyano-3,4-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: OPOUWJFXZRRHOV-JHJVBQTASA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4-diacetyloxy-6-cyano-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | OPOUWJFXZRRHOV-JHJVBQTASA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H](C=C(O1)C#N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)