CAS 120085-62-3 is the registry number for 4,5,7-Tri-O-acetyl-2,6-anhydro-3-deoxy-D-arabino-hept-2-enononitrile. Offered by: Biosynth. Available pack sizes: 10g.
[(2R,3S,4R)-3,4-diacetyloxy-6-cyano-3,4-dihydro-2H-pyran-2-yl]methyl acetate (CAS 120085-62-3) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: [(2R,3S,4R)-3,4-diacetyloxy-6-cyano-3,4-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: OPOUWJFXZRRHOV-UPJWGTAASA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | [(2R,3S,4R)-3,4-diacetyloxy-6-cyano-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | OPOUWJFXZRRHOV-UPJWGTAASA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H](C=C(O1)C#N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)