CAS 188891-18-1 is the registry number for 4-(4-Acetyl-2-methoxy-5-nitrophenoxy)butanoic Acid, >98.0%(HPLC)(qNMR). Offered by: TCI. Available pack sizes: 1g.
4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoic acid (CAS 188891-18-1) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoic acid. InChIKey: VLJYMVZNVOAIHI-UHFFFAOYSA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoic acid |
| InChIKey | VLJYMVZNVOAIHI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)O)OC |
Computed by PubChem (NCBI)