CAS 176375-42-1 is the registry number for methyl 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoate (CAS 176375-42-1) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: methyl 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoate. InChIKey: IAYUODHBFOOQCA-UHFFFAOYSA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | methyl 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoate |
| InChIKey | IAYUODHBFOOQCA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCCCC(=O)OC |
Computed by PubChem (NCBI)