Products 1096877-81-4
CAS 1096877-81-4 is the registry number for 5-Methoxy-2-nitro-4-(oxolan-2-ylmethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methoxy-2-nitro-4-(oxolan-2-ylmethoxy)benzoic acid (CAS 1096877-81-4) is a chemical compound with the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. IUPAC name: 5-methoxy-2-nitro-4-(oxolan-2-ylmethoxy)benzoic acid. InChIKey: BZJQHIABMUYYRN-UHFFFAOYSA-N.
| Molecular formula | C13H15NO7 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 5-methoxy-2-nitro-4-(oxolan-2-ylmethoxy)benzoic acid |
| InChIKey | BZJQHIABMUYYRN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC2CCCO2 |
Computed by PubChem (NCBI)