Products 101642-77-7

CAS 101642-77-7 is the registry number for Cbz-DL-3-Aminoisobutyric acid. Offered by: Creative Peptides. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 101642-77-7) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: YDSJUQJHDFBDSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO4
Molecular weight237.25 g/mol
IUPAC name2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid
InChIKeyYDSJUQJHDFBDSZ-UHFFFAOYSA-N
SMILESCC(CNC(=O)OCC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)