CAS 1016690-39-3 appears in our catalog under these names: 2-(Propan-2-yloxy)pyridine-3-carboxylic acid, 2-(Propan-2-yloxy)pyridine-3-carboxylic acid, 95%, 2-Isopropoxynicotinic acid, 98%, 98%, 2-(Propan-2-yloxy)pyridine-3-carboxylic acid, ≥95%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 1g, 250mg, 100mg.
2-propan-2-yloxypyridine-3-carboxylic acid (CAS 1016690-39-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-propan-2-yloxypyridine-3-carboxylic acid. InChIKey: FDVRXYBXOOUUQY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-propan-2-yloxypyridine-3-carboxylic acid |
| InChIKey | FDVRXYBXOOUUQY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)