Products 1016703-35-7
CAS 1016703-35-7 appears in our catalog under these names: 4-[(2-Methoxy-4-nitrophenyl)amino]butanoic acid, 95%, 4-((2-Methoxy-4-nitrophenyl)amino)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(2-methoxy-4-nitroanilino)butanoic acid (CAS 1016703-35-7) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 4-(2-methoxy-4-nitroanilino)butanoic acid. InChIKey: WNEXYSRMIICHHP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 4-(2-methoxy-4-nitroanilino)butanoic acid |
| InChIKey | WNEXYSRMIICHHP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])NCCCC(=O)O |
Computed by PubChem (NCBI)