Products 4097-50-1
CAS 4097-50-1 appears in our catalog under these names: 4-tert-Anyl-2,6-dinitrophenol, 95%, 4–Tert–anyl–2，6–dinitrophenol, 4-Tert-anyl-2,6-dinitrophenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-(2-methylbutan-2-yl)-2,6-dinitrophenol (CAS 4097-50-1) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 4-(2-methylbutan-2-yl)-2,6-dinitrophenol. InChIKey: BTFCDCNHRPIDHR-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 4-(2-methylbutan-2-yl)-2,6-dinitrophenol |
| InChIKey | BTFCDCNHRPIDHR-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C(=C1)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)