CAS 481053-42-3 is the registry number for N-(2,2-Dimethoxyethyl)-4-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(2,2-dimethoxyethyl)-4-nitrobenzamide (CAS 481053-42-3) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: N-(2,2-dimethoxyethyl)-4-nitrobenzamide. InChIKey: JNFSCTMIDDWUKA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | N-(2,2-dimethoxyethyl)-4-nitrobenzamide |
| InChIKey | JNFSCTMIDDWUKA-UHFFFAOYSA-N |
| SMILES | COC(CNC(=O)C1=CC=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)