Products 1338346-21-6

CAS 1338346-21-6 is the registry number for 2-Methyl-4-([2-(methyloxy)ethyl]amino)-5-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-methoxyethylamino)-2-methyl-5-nitrobenzoic acid (CAS 1338346-21-6) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 4-(2-methoxyethylamino)-2-methyl-5-nitrobenzoic acid. InChIKey: FEJJQZRMYNCLMD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O5
Molecular weight254.24 g/mol
IUPAC name4-(2-methoxyethylamino)-2-methyl-5-nitrobenzoic acid
InChIKeyFEJJQZRMYNCLMD-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])NCCOC

Computed by PubChem (NCBI)