Products 55520-67-7
CAS 55520-67-7 appears in our catalog under these names: Brivudine Impurity 10, Brivudine Impurity 25, 1-((2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-vinylpyrimidine-2,4(1H,3H)-dione, 97%, 5–Vinyl–2'–deoxyuridine, 2-Deoxy-5-vinyluridine. Offered by: Chemat Brand, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 25mg, 200mg, 100mg, 500mg, 1000mg, 250mg, 1g.
5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 55520-67-7) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: YAAQOXBNCODRSI-DJLDLDEBSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | YAAQOXBNCODRSI-DJLDLDEBSA-N |
| SMILES | C=CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)