CAS 1987057-78-2 is the registry number for 4-[(3,5-Dimethylisoxazol-4-yl)methyl]-5-methylisoxazole-3-carboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 25g, 10g, 5g, 1g.
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid;hydrate (CAS 1987057-78-2) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid;hydrate. InChIKey: CXASNULKFUJSDK-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid;hydrate |
| InChIKey | CXASNULKFUJSDK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CC2=C(ON=C2C(=O)O)C.O |
Computed by PubChem (NCBI)