CAS 201811-18-9 appears in our catalog under these names: Carbonic acid 4-amino-3-nitro-phenyl ester tert-butyl ester, 95%, Carbonic acid 4-amino-3-nitro-phenyl ester tert-butyl ester, 97%, 97%, 4-Amino-3-nitrophenyl tert-butyl carbonate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g, 2g.
(4-amino-3-nitrophenyl) tert-butyl carbonate (CAS 201811-18-9) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: (4-amino-3-nitrophenyl) tert-butyl carbonate. InChIKey: GBHDRLLCJYKRJB-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | (4-amino-3-nitrophenyl) tert-butyl carbonate |
| InChIKey | GBHDRLLCJYKRJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)